C24H21F3N6O4 — CID 177315305
1-methyl-5-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-oxo-1,6-naphthyridine-8-carbonitrile (PubChem CID 177315305) has the molecular formula C24H21F3N6O4 and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-methyl-5-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-oxo-1,6-naphthyridine-8-carbonitrile.
| Compound Name | 1-methyl-5-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-oxo-1,6-naphthyridine-8-carbonitrile |
|---|---|
| PubChem CID | 177315305 |
| Molecular Formula | C24H21F3N6O4 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 1-methyl-5-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-oxo-1,6-naphthyridine-8-carbonitrile |
| SMILES | C[C@@H](Nc1ncc(C#N)c2c1cc(N1CC3(COC3)C1)c(=O)n2C)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N6O4/c1-13(14-3-16(24(25,26)27)5-17(4-14)33(35)36)30-21-18-6-19(32-9-23(10-32)11-37-12-23)22(34)31(2)20(18)15(7-28)8-29-21/h3-6,8,13H,9-12H2,1-2H3,(H,29,30)/t13-/m1/s1 |
| InChIKey | YIBAPTIGOLFZJM-CYBMUJFWSA-N |
| XLogP | 3.74 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|