About (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine
(1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine (PubChem CID 177316289) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine |
| PubChem CID | 177316289 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine |
| SMILES | C/C=C(N)/C(C)=C/N=C/C |
| InChI | InChI=1S/C8H14N2/c1-4-8(9)7(3)6-10-5-2/h4-6H,9H2,1-3H3/b7-6+,8-4-,10-5+ |
| InChIKey | ADZKCKLEZHCSPH-XIOAJFKVSA-N |
| XLogP | 1.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine?
The IUPAC name of (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine (CID 177316289) is (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine.
What is the SMILES notation for (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine?
The canonical SMILES for (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine is C/C=C(N)/C(C)=C/N=C/C.
What is the InChIKey of (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine?
The InChIKey is ADZKCKLEZHCSPH-XIOAJFKVSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8(9)7(3)6-10-5-2/h4-6H,9H2,1-3H3/b7-6+,8-4-,10-5+.
What are the key properties of (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine?
(1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine has a molecular weight of 138.21 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-1-(ethylideneamino)-2-methylpenta-1,3-dien-3-amine is sourced from PubChem (CID 177316289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).