About 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine
3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine (PubChem CID 177316412) has the molecular formula C19H13ClFN3
and a molecular weight of 337.79 g/mol. Its IUPAC name is 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine |
| PubChem CID | 177316412 |
| Molecular Formula | C19H13ClFN3 |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine |
| SMILES | Fc1ccc(-c2cnn3ncc(-c4ccc(CCl)cc4)c3c2)cc1 |
| InChI | InChI=1S/C19H13ClFN3/c20-10-13-1-3-15(4-2-13)18-12-23-24-19(18)9-16(11-22-24)14-5-7-17(21)8-6-14/h1-9,11-12H,10H2 |
| InChIKey | VQKLBVDQLPRJKG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine?
The IUPAC name of 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine (CID 177316412) is 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine.
What is the SMILES notation for 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine?
The canonical SMILES for 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine is Fc1ccc(-c2cnn3ncc(-c4ccc(CCl)cc4)c3c2)cc1.
What is the InChIKey of 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine?
The InChIKey is VQKLBVDQLPRJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClFN3/c20-10-13-1-3-15(4-2-13)18-12-23-24-19(18)9-16(11-22-24)14-5-7-17(21)8-6-14/h1-9,11-12H,10H2.
What are the key properties of 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine?
3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine has a molecular weight of 337.79 g/mol, XLogP of 4.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)pyrazolo[1,5-b]pyridazine is sourced from PubChem (CID 177316412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).