C6H12FNO — CID 177317200
(3R,4R)-N-ethyl-4-fluorooxolan-3-amine (PubChem CID 177317200) has the molecular formula C6H12FNO and a molecular weight of 133.17 g/mol. Its IUPAC name is (3R,4R)-N-ethyl-4-fluorooxolan-3-amine.
| Compound Name | (3R,4R)-N-ethyl-4-fluorooxolan-3-amine |
|---|---|
| PubChem CID | 177317200 |
| Molecular Formula | C6H12FNO |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (3R,4R)-N-ethyl-4-fluorooxolan-3-amine |
| SMILES | CCN[C@@H]1COC[C@@H]1F |
| InChI | InChI=1S/C6H12FNO/c1-2-8-6-4-9-3-5(6)7/h5-6,8H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | SAACSYQAIFLSPO-NTSWFWBYSA-N |
| XLogP | 0.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |