C16H29NO — CID 177317217
ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-2,6-dimethyloxan-4-amine (PubChem CID 177317217) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-2,6-dimethyloxan-4-amine.
| Compound Name | ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-2,6-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 177317217 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-2,6-dimethyloxan-4-amine |
| SMILES | C=C/C=C(\C=C)CNC1CC(C)OC(C)C1.CC |
| InChI | InChI=1S/C14H23NO.C2H6/c1-5-7-13(6-2)10-15-14-8-11(3)16-12(4)9-14;1-2/h5-7,11-12,14-15H,1-2,8-10H2,3-4H3;1-2H3/b13-7+; |
| InChIKey | QOUMCCKPDDOFRO-FTPOTTDRSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|