About 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane
6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane (PubChem CID 177317893) has the molecular formula C15H25F3N6
and a molecular weight of 346.40 g/mol. Its IUPAC name is 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane.
Molecular Properties
| Compound Name | 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane |
| PubChem CID | 177317893 |
| Molecular Formula | C15H25F3N6 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane |
| SMILES | CC.CN1CCN(c2nc(N)c(F)c(N3CCC(F)(F)C3)n2)CC1 |
| InChI | InChI=1S/C13H19F3N6.C2H6/c1-20-4-6-21(7-5-20)12-18-10(17)9(14)11(19-12)22-3-2-13(15,16)8-22;1-2/h2-8H2,1H3,(H2,17,18,19);1-2H3 |
| InChIKey | ZRPJCXARICRUQS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane?
The IUPAC name of 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane (CID 177317893) is 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane.
What is the SMILES notation for 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane?
The canonical SMILES for 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane is CC.CN1CCN(c2nc(N)c(F)c(N3CCC(F)(F)C3)n2)CC1.
What is the InChIKey of 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane?
The InChIKey is ZRPJCXARICRUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N6.C2H6/c1-20-4-6-21(7-5-20)12-18-10(17)9(14)11(19-12)22-3-2-13(15,16)8-22;1-2/h2-8H2,1H3,(H2,17,18,19);1-2H3.
What are the key properties of 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane?
6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane has a molecular weight of 346.40 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-difluoropyrrolidin-1-yl)-5-fluoro-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine;ethane is sourced from PubChem (CID 177317893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).