About ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide
ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide (PubChem CID 177318198) has the molecular formula C20H36N4O
and a molecular weight of 348.54 g/mol. Its IUPAC name is ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide.
Molecular Properties
| Compound Name | ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide |
| PubChem CID | 177318198 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide |
| SMILES | CC.CCCCCCNNC(=O)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C18H30N4O.C2H6/c1-3-4-5-6-11-19-20-18(23)16-7-9-17(10-8-16)22-14-12-21(2)13-15-22;1-2/h7-10,19H,3-6,11-15H2,1-2H3,(H,20,23);1-2H3 |
| InChIKey | RLOURCWVCOCMLI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide?
The IUPAC name of ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide (CID 177318198) is ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide.
What is the SMILES notation for ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide?
The canonical SMILES for ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide is CC.CCCCCCNNC(=O)c1ccc(N2CCN(C)CC2)cc1.
What is the InChIKey of ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide?
The InChIKey is RLOURCWVCOCMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O.C2H6/c1-3-4-5-6-11-19-20-18(23)16-7-9-17(10-8-16)22-14-12-21(2)13-15-22;1-2/h7-10,19H,3-6,11-15H2,1-2H3,(H,20,23);1-2H3.
What are the key properties of ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide?
ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide has a molecular weight of 348.54 g/mol, XLogP of 3.28, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-hexyl-4-(4-methylpiperazin-1-yl)benzohydrazide is sourced from PubChem (CID 177318198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).