About ethane;methanol;4-(4-nitrophenyl)morpholine
ethane;methanol;4-(4-nitrophenyl)morpholine (PubChem CID 177318557) has the molecular formula C17H34N2O4
and a molecular weight of 330.47 g/mol. Its IUPAC name is ethane;methanol;4-(4-nitrophenyl)morpholine.
Molecular Properties
| Compound Name | ethane;methanol;4-(4-nitrophenyl)morpholine |
| PubChem CID | 177318557 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | ethane;methanol;4-(4-nitrophenyl)morpholine |
| SMILES | CC.CC.CC.CO.O=[N+]([O-])c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C10H12N2O3.3C2H6.CH4O/c13-12(14)10-3-1-9(2-4-10)11-5-7-15-8-6-11;4*1-2/h1-4H,5-8H2;3*1-2H3;2H,1H3 |
| InChIKey | BUAUHQNRMBDKCF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanol;4-(4-nitrophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;4-(4-nitrophenyl)morpholine?
The IUPAC name of ethane;methanol;4-(4-nitrophenyl)morpholine (CID 177318557) is ethane;methanol;4-(4-nitrophenyl)morpholine.
What is the SMILES notation for ethane;methanol;4-(4-nitrophenyl)morpholine?
The canonical SMILES for ethane;methanol;4-(4-nitrophenyl)morpholine is CC.CC.CC.CO.O=[N+]([O-])c1ccc(N2CCOCC2)cc1.
What is the InChIKey of ethane;methanol;4-(4-nitrophenyl)morpholine?
The InChIKey is BUAUHQNRMBDKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3.3C2H6.CH4O/c13-12(14)10-3-1-9(2-4-10)11-5-7-15-8-6-11;4*1-2/h1-4H,5-8H2;3*1-2H3;2H,1H3.
What are the key properties of ethane;methanol;4-(4-nitrophenyl)morpholine?
ethane;methanol;4-(4-nitrophenyl)morpholine has a molecular weight of 330.47 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;4-(4-nitrophenyl)morpholine is sourced from PubChem (CID 177318557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).