About (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite
(2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite (PubChem CID 177318832) has the molecular formula C8H11ClN2S2
and a molecular weight of 234.78 g/mol. Its IUPAC name is (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite.
Molecular Properties
| Compound Name | (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite |
| PubChem CID | 177318832 |
| Molecular Formula | C8H11ClN2S2 |
| Molecular Weight | 234.78 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite |
| SMILES | ClSc1cnc(C2CCCNC2)s1 |
| InChI | InChI=1S/C8H11ClN2S2/c9-13-7-5-11-8(12-7)6-2-1-3-10-4-6/h5-6,10H,1-4H2 |
| InChIKey | FAURPMCZTFNKDP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite?
The IUPAC name of (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite (CID 177318832) is (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite.
What is the SMILES notation for (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite?
The canonical SMILES for (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite is ClSc1cnc(C2CCCNC2)s1.
What is the InChIKey of (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite?
The InChIKey is FAURPMCZTFNKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2S2/c9-13-7-5-11-8(12-7)6-2-1-3-10-4-6/h5-6,10H,1-4H2.
What are the key properties of (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite?
(2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite has a molecular weight of 234.78 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-piperidin-3-yl-1,3-thiazol-5-yl) thiohypochlorite is sourced from PubChem (CID 177318832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).