C14H13F2N3S2 — CID 177318923
3-(difluoromethyl)-4-methyl-N-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]-1H-indol-7-amine (PubChem CID 177318923) has the molecular formula C14H13F2N3S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-methyl-N-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]-1H-indol-7-amine.
| Compound Name | 3-(difluoromethyl)-4-methyl-N-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]-1H-indol-7-amine |
|---|---|
| PubChem CID | 177318923 |
| Molecular Formula | C14H13F2N3S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-(difluoromethyl)-4-methyl-N-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]-1H-indol-7-amine |
| SMILES | Cc1ncc(SNc2ccc(C)c3c(C(F)F)c[nH]c23)s1 |
| InChI | InChI=1S/C14H13F2N3S2/c1-7-3-4-10(19-21-11-6-17-8(2)20-11)13-12(7)9(5-18-13)14(15)16/h3-6,14,18-19H,1-2H3 |
| InChIKey | ZTAGNPCUJWYCRO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|