C8H14O2 — CID 177319356
3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol (PubChem CID 177319356) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol.
| Compound Name | 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 177319356 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol |
| SMILES | C=C(/C=C\C)OCCCO |
| InChI | InChI=1S/C8H14O2/c1-3-5-8(2)10-7-4-6-9/h3,5,9H,2,4,6-7H2,1H3/b5-3- |
| InChIKey | DTFDLZAFDUSFLV-HYXAFXHYSA-N |
| XLogP | 1.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|