About 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol
3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol (PubChem CID 177319356) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol.
Molecular Properties
| Compound Name | 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol |
| PubChem CID | 177319356 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol |
| SMILES | C=C(/C=C\C)OCCCO |
| InChI | InChI=1S/C8H14O2/c1-3-5-8(2)10-7-4-6-9/h3,5,9H,2,4,6-7H2,1H3/b5-3- |
| InChIKey | DTFDLZAFDUSFLV-HYXAFXHYSA-N |
| XLogP | 1.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol?
The IUPAC name of 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol (CID 177319356) is 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol.
What is the SMILES notation for 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol?
The canonical SMILES for 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol is C=C(/C=C\C)OCCCO.
What is the InChIKey of 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol?
The InChIKey is DTFDLZAFDUSFLV-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-5-8(2)10-7-4-6-9/h3,5,9H,2,4,6-7H2,1H3/b5-3-.
What are the key properties of 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol?
3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol has a molecular weight of 142.20 g/mol, XLogP of 1.48, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z)-penta-1,3-dien-2-yl]oxypropan-1-ol is sourced from PubChem (CID 177319356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).