About 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane
2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane (PubChem CID 177319583) has the molecular formula C11H21FN2
and a molecular weight of 200.30 g/mol. Its IUPAC name is 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 177319583 |
| Molecular Formula | C11H21FN2 |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane |
| SMILES | CCN1CCC2(CN(C)CC2(C)F)C1 |
| InChI | InChI=1S/C11H21FN2/c1-4-14-6-5-11(9-14)8-13(3)7-10(11,2)12/h4-9H2,1-3H3 |
| InChIKey | IXSOSNCMURHKKX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane (CID 177319583) is 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane is CCN1CCC2(CN(C)CC2(C)F)C1.
What is the InChIKey of 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane?
The InChIKey is IXSOSNCMURHKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FN2/c1-4-14-6-5-11(9-14)8-13(3)7-10(11,2)12/h4-9H2,1-3H3.
What are the key properties of 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane?
2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane has a molecular weight of 200.30 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-9-fluoro-7,9-dimethyl-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 177319583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).