About acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane
acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane (PubChem CID 177319662) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane.
Molecular Properties
| Compound Name | acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane |
| PubChem CID | 177319662 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane |
| SMILES | C#C.C/C=C(/CCCN)OCC.CCC |
| InChI | InChI=1S/C8H17NO.C3H8.C2H2/c1-3-8(10-4-2)6-5-7-9;1-3-2;1-2/h3H,4-7,9H2,1-2H3;3H2,1-2H3;1-2H/b8-3-;; |
| InChIKey | FRUVAIPNFGBMMJ-AFLHAROQSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane?
The IUPAC name of acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane (CID 177319662) is acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane.
What is the SMILES notation for acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane?
The canonical SMILES for acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane is C#C.C/C=C(/CCCN)OCC.CCC.
What is the InChIKey of acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane?
The InChIKey is FRUVAIPNFGBMMJ-AFLHAROQSA-N. The full InChI is InChI=1S/C8H17NO.C3H8.C2H2/c1-3-8(10-4-2)6-5-7-9;1-3-2;1-2/h3H,4-7,9H2,1-2H3;3H2,1-2H3;1-2H/b8-3-;;.
What are the key properties of acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane?
acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane has a molecular weight of 213.36 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(Z)-4-ethoxyhex-4-en-1-amine;propane is sourced from PubChem (CID 177319662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).