About 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine
3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine (PubChem CID 177319750) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine |
| PubChem CID | 177319750 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine |
| SMILES | C/C1=C(\CCCN)O/C=C\CCC1 |
| InChI | InChI=1S/C11H19NO/c1-10-6-3-2-4-9-13-11(10)7-5-8-12/h4,9H,2-3,5-8,12H2,1H3/b9-4-,11-10- |
| InChIKey | JFBIQDYHEZTYHC-ISIMONSRSA-N |
| XLogP | 2.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine?
The IUPAC name of 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine (CID 177319750) is 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine.
What is the SMILES notation for 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine?
The canonical SMILES for 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine is C/C1=C(\CCCN)O/C=C\CCC1.
What is the InChIKey of 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine?
The InChIKey is JFBIQDYHEZTYHC-ISIMONSRSA-N. The full InChI is InChI=1S/C11H19NO/c1-10-6-3-2-4-9-13-11(10)7-5-8-12/h4,9H,2-3,5-8,12H2,1H3/b9-4-,11-10-.
What are the key properties of 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine?
3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine has a molecular weight of 181.28 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2Z,7E)-3-methyl-5,6-dihydro-4H-oxocin-2-yl]propan-1-amine is sourced from PubChem (CID 177319750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).