About 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine
4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine (PubChem CID 177319858) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine |
| PubChem CID | 177319858 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine |
| SMILES | CNCCCCC1C=C(C)C=C(C)O1 |
| InChI | InChI=1S/C12H21NO/c1-10-8-11(2)14-12(9-10)6-4-5-7-13-3/h8-9,12-13H,4-7H2,1-3H3 |
| InChIKey | LUUOXZDLKRUXCE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine?
The IUPAC name of 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine (CID 177319858) is 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine.
What is the SMILES notation for 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine?
The canonical SMILES for 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine is CNCCCCC1C=C(C)C=C(C)O1.
What is the InChIKey of 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine?
The InChIKey is LUUOXZDLKRUXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-10-8-11(2)14-12(9-10)6-4-5-7-13-3/h8-9,12-13H,4-7H2,1-3H3.
What are the key properties of 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine?
4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine has a molecular weight of 195.31 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine is sourced from PubChem (CID 177319858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).