C13H25NO — CID 177320227
5-[(Z)-but-2-en-2-yl]oxy-N,6-dimethylhept-5-en-1-amine (PubChem CID 177320227) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 5-[(Z)-but-2-en-2-yl]oxy-N,6-dimethylhept-5-en-1-amine.
| Compound Name | 5-[(Z)-but-2-en-2-yl]oxy-N,6-dimethylhept-5-en-1-amine |
|---|---|
| PubChem CID | 177320227 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 5-[(Z)-but-2-en-2-yl]oxy-N,6-dimethylhept-5-en-1-amine |
| SMILES | C/C=C(/C)OC(CCCCNC)=C(C)C |
| InChI | InChI=1S/C13H25NO/c1-6-12(4)15-13(11(2)3)9-7-8-10-14-5/h6,14H,7-10H2,1-5H3/b12-6- |
| InChIKey | MFDWHTTWBXQWDT-SDQBBNPISA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|