C42H45ClFN3O4 — CID 177320278
N-[6-[2-(4-chlorophenyl)-1H-indol-3-yl]-3-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]hexyl]formamide (PubChem CID 177320278) has the molecular formula C42H45ClFN3O4 and a molecular weight of 710.29 g/mol. Its IUPAC name is N-[6-[2-(4-chlorophenyl)-1H-indol-3-yl]-3-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]hexyl]formamide.
| Compound Name | N-[6-[2-(4-chlorophenyl)-1H-indol-3-yl]-3-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]hexyl]formamide |
|---|---|
| PubChem CID | 177320278 |
| Molecular Formula | C42H45ClFN3O4 |
| Molecular Weight | 710.29 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | N-[6-[2-(4-chlorophenyl)-1H-indol-3-yl]-3-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]hexyl]formamide |
| SMILES | O=CNCCC(CCCc1c(-c2ccc(Cl)cc2)[nH]c2ccccc12)OCCOCCNCc1ccc2cc(CCc3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C42H45ClFN3O4/c43-34-15-13-32(14-16-34)42-39(38-5-1-2-7-40(38)47-42)6-3-4-36(20-21-46-29-48)50-25-24-49-23-22-45-28-31-8-12-33-27-37(51-41(33)26-31)19-11-30-9-17-35(44)18-10-30/h1-2,5,7-10,12-18,26-27,29,36,45,47H,3-4,6,11,19-25,28H2,(H,46,48) |
| InChIKey | CMOUIWOMSUKFMA-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.29 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|