C22H41NO5 — CID 177320418
2-methyl-N-[2-[2-[2-[2-(3-phenoxypropoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen (PubChem CID 177320418) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-(3-phenoxypropoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-(3-phenoxypropoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 177320418 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-(3-phenoxypropoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen |
| SMILES | CCC(C)CNCCOCCOCCOCCOCCCOc1ccccc1.[H][H] |
| InChI | InChI=1S/C22H39NO5.H2/c1-3-21(2)20-23-10-13-25-15-17-27-19-18-26-16-14-24-11-7-12-28-22-8-5-4-6-9-22;/h4-6,8-9,21,23H,3,7,10-20H2,1-2H3;1H |
| InChIKey | UFYHKTLYMOOFHX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|