About 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene
2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene (PubChem CID 177321080) has the molecular formula C19H19FS
and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene.
Molecular Properties
| Compound Name | 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene |
| PubChem CID | 177321080 |
| Molecular Formula | C19H19FS |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene |
| SMILES | CCC1=CC=C(c2ccc(-c3ccc(C)s3)c(F)c2)CC1 |
| InChI | InChI=1S/C19H19FS/c1-3-14-5-7-15(8-6-14)16-9-10-17(18(20)12-16)19-11-4-13(2)21-19/h4-5,7,9-12H,3,6,8H2,1-2H3 |
| InChIKey | QMONQDJAAFZNOE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene?
The IUPAC name of 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene (CID 177321080) is 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene.
What is the SMILES notation for 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene?
The canonical SMILES for 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene is CCC1=CC=C(c2ccc(-c3ccc(C)s3)c(F)c2)CC1.
What is the InChIKey of 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene?
The InChIKey is QMONQDJAAFZNOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FS/c1-3-14-5-7-15(8-6-14)16-9-10-17(18(20)12-16)19-11-4-13(2)21-19/h4-5,7,9-12H,3,6,8H2,1-2H3.
What are the key properties of 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene?
2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene has a molecular weight of 298.43 g/mol, XLogP of 6.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-ethylcyclohexa-1,3-dien-1-yl)-2-fluorophenyl]-5-methylthiophene is sourced from PubChem (CID 177321080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).