C18H32F3N3O2 — CID 177321199
tert-butyl 4-[2-[[4-(trifluoromethyl)piperidin-4-yl]amino]ethyl]piperidine-1-carboxylate (PubChem CID 177321199) has the molecular formula C18H32F3N3O2 and a molecular weight of 379.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-(trifluoromethyl)piperidin-4-yl]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-(trifluoromethyl)piperidin-4-yl]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177321199 |
| Molecular Formula | C18H32F3N3O2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | tert-butyl 4-[2-[[4-(trifluoromethyl)piperidin-4-yl]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCNC2(C(F)(F)F)CCNCC2)CC1 |
| InChI | InChI=1S/C18H32F3N3O2/c1-16(2,3)26-15(25)24-12-5-14(6-13-24)4-9-23-17(18(19,20)21)7-10-22-11-8-17/h14,22-23H,4-13H2,1-3H3 |
| InChIKey | YNMHGFYHBYWXGZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |