C20H37F3O — CID 177321425
2,5,6,10-tetramethyl-9-methylidene-13-(trifluoromethoxy)tetradecane (PubChem CID 177321425) has the molecular formula C20H37F3O and a molecular weight of 350.51 g/mol. Its IUPAC name is 2,5,6,10-tetramethyl-9-methylidene-13-(trifluoromethoxy)tetradecane.
| Compound Name | 2,5,6,10-tetramethyl-9-methylidene-13-(trifluoromethoxy)tetradecane |
|---|---|
| PubChem CID | 177321425 |
| Molecular Formula | C20H37F3O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 2,5,6,10-tetramethyl-9-methylidene-13-(trifluoromethoxy)tetradecane |
| SMILES | C=C(CCC(C)C(C)CCC(C)C)C(C)CCC(C)OC(F)(F)F |
| InChI | InChI=1S/C20H37F3O/c1-14(2)8-9-15(3)16(4)10-11-17(5)18(6)12-13-19(7)24-20(21,22)23/h14-16,18-19H,5,8-13H2,1-4,6-7H3 |
| InChIKey | SAAJORNYAKXSNG-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|