C22H31F3IN3O — CID 177321512
(E)-2-(8-iodo-1,8-dimethyl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile (PubChem CID 177321512) has the molecular formula C22H31F3IN3O and a molecular weight of 537.41 g/mol. Its IUPAC name is (E)-2-(8-iodo-1,8-dimethyl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(8-iodo-1,8-dimethyl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 177321512 |
| Molecular Formula | C22H31F3IN3O |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | (E)-2-(8-iodo-1,8-dimethyl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile |
| SMILES | CC1C2CC(C)(I)CCCC2CCN1C(=O)/C(C#N)=C/C1NCCCC1C(F)(F)F |
| InChI | InChI=1S/C22H31F3IN3O/c1-14-17-12-21(2,26)8-3-5-15(17)7-10-29(14)20(30)16(13-27)11-19-18(22(23,24)25)6-4-9-28-19/h11,14-15,17-19,28H,3-10,12H2,1-2H3/b16-11+ |
| InChIKey | RBYWJIUJZAXJTB-LFIBNONCSA-N |
| XLogP | 4.99 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|