C19H25F2IN2O — CID 177321521
(E)-2-[1-(difluoromethyl)-8-iodo-1,3,4,4a,5,6,9,9a-octahydrocyclohepta[c]pyridine-2-carbonyl]-4,4-dimethylpent-2-enenitrile (PubChem CID 177321521) has the molecular formula C19H25F2IN2O and a molecular weight of 462.32 g/mol. Its IUPAC name is (E)-2-[1-(difluoromethyl)-8-iodo-1,3,4,4a,5,6,9,9a-octahydrocyclohepta[c]pyridine-2-carbonyl]-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-[1-(difluoromethyl)-8-iodo-1,3,4,4a,5,6,9,9a-octahydrocyclohepta[c]pyridine-2-carbonyl]-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 177321521 |
| Molecular Formula | C19H25F2IN2O |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (E)-2-[1-(difluoromethyl)-8-iodo-1,3,4,4a,5,6,9,9a-octahydrocyclohepta[c]pyridine-2-carbonyl]-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C)/C=C(\C#N)C(=O)N1CCC2CCC=C(I)CC2C1C(F)F |
| InChI | InChI=1S/C19H25F2IN2O/c1-19(2,3)10-13(11-23)18(25)24-8-7-12-5-4-6-14(22)9-15(12)16(24)17(20)21/h6,10,12,15-17H,4-5,7-9H2,1-3H3/b13-10+ |
| InChIKey | OHXJKWJVSOYNAE-JLHYYAGUSA-N |
| XLogP | 5.08 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|