C19H29IN2O2 — CID 177321558
(E)-5-hydroxy-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile (PubChem CID 177321558) has the molecular formula C19H29IN2O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is (E)-5-hydroxy-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-5-hydroxy-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 177321558 |
| Molecular Formula | C19H29IN2O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-5-hydroxy-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CC1C2CC(I)CCCC2CCN1C(=O)/C(C#N)=C/C(C)(C)CO |
| InChI | InChI=1S/C19H29IN2O2/c1-13-17-9-16(20)6-4-5-14(17)7-8-22(13)18(24)15(11-21)10-19(2,3)12-23/h10,13-14,16-17,23H,4-9,12H2,1-3H3/b15-10+ |
| InChIKey | GJCQQJZQSYNFKG-XNTDXEJSSA-N |
| XLogP | 3.69 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|