C18H27IN2O — CID 177321798
(E)-2-(8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile (PubChem CID 177321798) has the molecular formula C18H27IN2O and a molecular weight of 414.33 g/mol. Its IUPAC name is (E)-2-(8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 177321798 |
| Molecular Formula | C18H27IN2O |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (E)-2-(8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C)/C=C(\C#N)C(=O)N1CCC2CCCC(I)CC2C1 |
| InChI | InChI=1S/C18H27IN2O/c1-18(2,3)10-15(11-20)17(22)21-8-7-13-5-4-6-16(19)9-14(13)12-21/h10,13-14,16H,4-9,12H2,1-3H3/b15-10+ |
| InChIKey | DEWHWRBTNOJLLO-XNTDXEJSSA-N |
| XLogP | 4.32 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|