C21H29F3IN3O — CID 177321863
(E)-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile (PubChem CID 177321863) has the molecular formula C21H29F3IN3O and a molecular weight of 523.38 g/mol. Its IUPAC name is (E)-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 177321863 |
| Molecular Formula | C21H29F3IN3O |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (E)-2-(8-iodo-1-methyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-3-[3-(trifluoromethyl)piperidin-2-yl]prop-2-enenitrile |
| SMILES | CC1C2CC(I)CCCC2CCN1C(=O)/C(C#N)=C/C1NCCCC1C(F)(F)F |
| InChI | InChI=1S/C21H29F3IN3O/c1-13-17-11-16(25)5-2-4-14(17)7-9-28(13)20(29)15(12-26)10-19-18(21(22,23)24)6-3-8-27-19/h10,13-14,16-19,27H,2-9,11H2,1H3/b15-10+ |
| InChIKey | CZQXMOPVZSLSAV-XNTDXEJSSA-N |
| XLogP | 4.60 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|