C20H30FIN2O — CID 177321954
(E)-2-(1-ethyl-8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-5-fluoro-4,4-dimethylpent-2-enenitrile (PubChem CID 177321954) has the molecular formula C20H30FIN2O and a molecular weight of 460.38 g/mol. Its IUPAC name is (E)-2-(1-ethyl-8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-5-fluoro-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(1-ethyl-8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-5-fluoro-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 177321954 |
| Molecular Formula | C20H30FIN2O |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (E)-2-(1-ethyl-8-iodo-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine-2-carbonyl)-5-fluoro-4,4-dimethylpent-2-enenitrile |
| SMILES | CCC1C2CC(I)CCCC2CCN1C(=O)/C(C#N)=C/C(C)(C)CF |
| InChI | InChI=1S/C20H30FIN2O/c1-4-18-17-10-16(22)7-5-6-14(17)8-9-24(18)19(25)15(12-23)11-20(2,3)13-21/h11,14,16-18H,4-10,13H2,1-3H3/b15-11+ |
| InChIKey | FOVXBJKJQFDYEL-RVDMUPIBSA-N |
| XLogP | 5.05 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|