C22H35IN2O — CID 177322040
(E)-2-(8-iodo-8-methyl-1-propan-2-yl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile (PubChem CID 177322040) has the molecular formula C22H35IN2O and a molecular weight of 470.44 g/mol. Its IUPAC name is (E)-2-(8-iodo-8-methyl-1-propan-2-yl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(8-iodo-8-methyl-1-propan-2-yl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 177322040 |
| Molecular Formula | C22H35IN2O |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (E)-2-(8-iodo-8-methyl-1-propan-2-yl-3,4,4a,5,6,7,9,9a-octahydro-1H-cyclohepta[c]pyridine-2-carbonyl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)C1C2CC(C)(I)CCCC2CCN1C(=O)/C(C#N)=C/C(C)(C)C |
| InChI | InChI=1S/C22H35IN2O/c1-15(2)19-18-13-22(6,23)10-7-8-16(18)9-11-25(19)20(26)17(14-24)12-21(3,4)5/h12,15-16,18-19H,7-11,13H2,1-6H3/b17-12+ |
| InChIKey | UCCSSSNYWFTNTC-SFQUDFHCSA-N |
| XLogP | 5.74 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|