About 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine
2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine (PubChem CID 177322769) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine |
| PubChem CID | 177322769 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC1CCNC(C)(C)C1 |
| InChI | InChI=1S/C11H24N2O/c1-11(2)9-10(5-6-12-11)14-8-7-13(3)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | XFCJNPVXXVSPCJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine?
The IUPAC name of 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine (CID 177322769) is 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine is CN(C)CCOC1CCNC(C)(C)C1.
What is the InChIKey of 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine?
The InChIKey is XFCJNPVXXVSPCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-11(2)9-10(5-6-12-11)14-8-7-13(3)4/h10,12H,5-9H2,1-4H3.
What are the key properties of 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine?
2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine has a molecular weight of 200.33 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpiperidin-4-yl)oxy-N,N-dimethylethanamine is sourced from PubChem (CID 177322769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).