C26H33N7O3 — CID 177324399
2-[9-methyl-12-[1-[2-(1,2-oxazol-3-yloxy)ethyl]piperidin-4-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol (PubChem CID 177324399) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is 2-[9-methyl-12-[1-[2-(1,2-oxazol-3-yloxy)ethyl]piperidin-4-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol.
| Compound Name | 2-[9-methyl-12-[1-[2-(1,2-oxazol-3-yloxy)ethyl]piperidin-4-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
|---|---|
| PubChem CID | 177324399 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 2-[9-methyl-12-[1-[2-(1,2-oxazol-3-yloxy)ethyl]piperidin-4-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
| SMILES | CC1Nc2nnc(-c3ccccc3O)cc2N2CCN(C3CCN(CCOc4ccon4)CC3)CC12 |
| InChI | InChI=1S/C26H33N7O3/c1-18-23-17-32(19-6-9-31(10-7-19)13-15-35-25-8-14-36-30-25)11-12-33(23)22-16-21(28-29-26(22)27-18)20-4-2-3-5-24(20)34/h2-5,8,14,16,18-19,23,34H,6-7,9-13,15,17H2,1H3,(H,27,29) |
| InChIKey | HXTIJKQEVYQTSE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |