C27H37ClN2O4S — CID 177325074
(2R)-4-[(3R)-7-chloro-3-cyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-methylbutanoic acid (PubChem CID 177325074) has the molecular formula C27H37ClN2O4S and a molecular weight of 521.12 g/mol. Its IUPAC name is (2R)-4-[(3R)-7-chloro-3-cyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-methylbutanoic acid.
| Compound Name | (2R)-4-[(3R)-7-chloro-3-cyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 177325074 |
| Molecular Formula | C27H37ClN2O4S |
| Molecular Weight | 521.12 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (2R)-4-[(3R)-7-chloro-3-cyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-methylbutanoic acid |
| SMILES | C=C/C=C(\C=C/C)N1C[C@@H](C2CCCCC2)N(C)S(=O)(=O)c2cc(CC[C@@H](C)C(=O)O)c(Cl)cc21 |
| InChI | InChI=1S/C27H37ClN2O4S/c1-5-10-22(11-6-2)30-18-25(20-12-8-7-9-13-20)29(4)35(33,34)26-16-21(23(28)17-24(26)30)15-14-19(3)27(31)32/h5-6,10-11,16-17,19-20,25H,1,7-9,12-15,18H2,2-4H3,(H,31,32)/b11-6-,22-10+/t19-,25+/m1/s1 |
| InChIKey | NNRORKKEMCOSIO-MUTSZANZSA-N |
| XLogP | 6.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.12 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|