C27H34N4O5S — CID 177325084
1-[[3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]cyclopropane-1-carboxylic acid (PubChem CID 177325084) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is 1-[[3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 177325084 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 1-[[3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]cyclopropane-1-carboxylic acid |
| SMILES | CNc1cc2c(cc1C(=O)NC1(C(=O)O)CC1)S(=O)(=O)N(C)C(C1CCCCC1)CN2c1ccccc1 |
| InChI | InChI=1S/C27H34N4O5S/c1-28-21-16-22-24(15-20(21)25(32)29-27(13-14-27)26(33)34)37(35,36)30(2)23(18-9-5-3-6-10-18)17-31(22)19-11-7-4-8-12-19/h4,7-8,11-12,15-16,18,23,28H,3,5-6,9-10,13-14,17H2,1-2H3,(H,29,32)(H,33,34) |
| InChIKey | SXTMHVWAIKQKQI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |