About ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea
ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea (PubChem CID 177325754) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea.
Molecular Properties
| Compound Name | ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea |
| PubChem CID | 177325754 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea |
| SMILES | C=C/C=C(\C=C)NC(N)=S.CC |
| InChI | InChI=1S/C7H10N2S.C2H6/c1-3-5-6(4-2)9-7(8)10;1-2/h3-5H,1-2H2,(H3,8,9,10);1-2H3/b6-5+; |
| InChIKey | KYIBMGPIKCJLTF-IPZCTEOASA-N |
| XLogP | 2.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea?
The IUPAC name of ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea (CID 177325754) is ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea.
What is the SMILES notation for ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea?
The canonical SMILES for ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea is C=C/C=C(\C=C)NC(N)=S.CC.
What is the InChIKey of ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea?
The InChIKey is KYIBMGPIKCJLTF-IPZCTEOASA-N. The full InChI is InChI=1S/C7H10N2S.C2H6/c1-3-5-6(4-2)9-7(8)10;1-2/h3-5H,1-2H2,(H3,8,9,10);1-2H3/b6-5+;.
What are the key properties of ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea?
ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea has a molecular weight of 184.31 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(3E)-hexa-1,3,5-trien-3-yl]thiourea is sourced from PubChem (CID 177325754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).