C9H17NO — CID 177326112
6,6-dimethyl-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine (PubChem CID 177326112) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 6,6-dimethyl-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine.
| Compound Name | 6,6-dimethyl-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 177326112 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 6,6-dimethyl-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine |
| SMILES | CC1(C)CCC2COCCN21 |
| InChI | InChI=1S/C9H17NO/c1-9(2)4-3-8-7-11-6-5-10(8)9/h8H,3-7H2,1-2H3 |
| InChIKey | WZOKCXHTJFERQA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |