C25H39BO3Si — CID 177326136
tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy]silane (PubChem CID 177326136) has the molecular formula C25H39BO3Si and a molecular weight of 430.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy]silane |
|---|---|
| PubChem CID | 177326136 |
| Molecular Formula | C25H39BO3Si |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy]silane |
| SMILES | [2H]C([2H])(CO[Si](C)(C)C(C)(C)C)C([2H])([2H])c1cccc2cccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C25H39BO3Si/c1-23(2,3)30(8,9)27-18-12-16-20-14-10-13-19-15-11-17-21(22(19)20)26-28-24(4,5)25(6,7)29-26/h10-11,13-15,17H,12,16,18H2,1-9H3/i12D2,16D2 |
| InChIKey | DBJZHKKGGIENDE-USTDIDCUSA-N |
| XLogP | 6.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|