C18H28F3N — CID 177326666
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-prop-1-en-2-yl-3-(trifluoromethyl)pyrrolidine;propane (PubChem CID 177326666) has the molecular formula C18H28F3N and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-prop-1-en-2-yl-3-(trifluoromethyl)pyrrolidine;propane.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-prop-1-en-2-yl-3-(trifluoromethyl)pyrrolidine;propane |
|---|---|
| PubChem CID | 177326666 |
| Molecular Formula | C18H28F3N |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-prop-1-en-2-yl-3-(trifluoromethyl)pyrrolidine;propane |
| SMILES | C=C/C=C(\C=C/C)C1(C(F)(F)F)CCN(C(=C)C)C1.CCC |
| InChI | InChI=1S/C15H20F3N.C3H8/c1-5-7-13(8-6-2)14(15(16,17)18)9-10-19(11-14)12(3)4;1-3-2/h5-8H,1,3,9-11H2,2,4H3;3H2,1-2H3/b8-6-,13-7+; |
| InChIKey | JFIXWZQYEYBSAI-KAERSQBLSA-N |
| XLogP | 5.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|