About ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium
ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium (PubChem CID 177326898) has the molecular formula C11H21FNOV-
and a molecular weight of 253.24 g/mol. Its IUPAC name is ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium.
Molecular Properties
| Compound Name | ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium |
| PubChem CID | 177326898 |
| Molecular Formula | C11H21FNOV- |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium |
| SMILES | C=[C-]N1CCC(F)(COC)CC1.CC.[V] |
| InChI | InChI=1S/C9H15FNO.C2H6.V/c1-3-11-6-4-9(10,5-7-11)8-12-2;1-2;/h1,4-8H2,2H3;1-2H3;/q-1;; |
| InChIKey | KCRBKKQCBVZIAA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium?
The IUPAC name of ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium (CID 177326898) is ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium.
What is the SMILES notation for ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium?
The canonical SMILES for ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium is C=[C-]N1CCC(F)(COC)CC1.CC.[V].
What is the InChIKey of ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium?
The InChIKey is KCRBKKQCBVZIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FNO.C2H6.V/c1-3-11-6-4-9(10,5-7-11)8-12-2;1-2;/h1,4-8H2,2H3;1-2H3;/q-1;;.
What are the key properties of ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium?
ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium has a molecular weight of 253.24 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-4-fluoro-4-(methoxymethyl)piperidine;vanadium is sourced from PubChem (CID 177326898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).