C36H38F2N6O3 — CID 177327150
4-[8-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(3S)-3-methylpiperidin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-1-yl]but-3-ynyl carbamate (PubChem CID 177327150) has the molecular formula C36H38F2N6O3 and a molecular weight of 640.74 g/mol. Its IUPAC name is 4-[8-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(3S)-3-methylpiperidin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-1-yl]but-3-ynyl carbamate.
| Compound Name | 4-[8-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(3S)-3-methylpiperidin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-1-yl]but-3-ynyl carbamate |
|---|---|
| PubChem CID | 177327150 |
| Molecular Formula | C36H38F2N6O3 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | 4-[8-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(3S)-3-methylpiperidin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-1-yl]but-3-ynyl carbamate |
| SMILES | C[C@H]1CCCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(-c4cccc5cccc(C#CCCOC(N)=O)c45)ncc23)C1 |
| InChI | InChI=1S/C36H38F2N6O3/c1-23-8-6-15-43(20-23)33-28-19-40-31(27-13-5-12-25-11-4-10-24(29(25)27)9-2-3-17-46-34(39)45)30(38)32(28)41-35(42-33)47-22-36-14-7-16-44(36)21-26(37)18-36/h4-5,10-13,19,23,26H,3,6-8,14-18,20-22H2,1H3,(H2,39,45)/t23-,26+,36-/m0/s1 |
| InChIKey | IGHCHNLQZCQOSF-ZUDPPIGDSA-N |
| XLogP | 6.01 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|