About propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate
propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate (PubChem CID 177327377) has the molecular formula C9H13F2NO3
and a molecular weight of 221.20 g/mol. Its IUPAC name is propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate |
| PubChem CID | 177327377 |
| Molecular Formula | C9H13F2NO3 |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate |
| SMILES | CC(C)OC(=O)N1CCOC2C1C2(F)F |
| InChI | InChI=1S/C9H13F2NO3/c1-5(2)15-8(13)12-3-4-14-7-6(12)9(7,10)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | FRYRYOINFAZCAX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate?
The IUPAC name of propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate (CID 177327377) is propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate.
What is the SMILES notation for propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate?
The canonical SMILES for propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate is CC(C)OC(=O)N1CCOC2C1C2(F)F.
What is the InChIKey of propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate?
The InChIKey is FRYRYOINFAZCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO3/c1-5(2)15-8(13)12-3-4-14-7-6(12)9(7,10)11/h5-7H,3-4H2,1-2H3.
What are the key properties of propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate?
propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate has a molecular weight of 221.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane-5-carboxylate is sourced from PubChem (CID 177327377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).