C30H48BFO5Si — CID 177327511
3-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy-tri(propan-2-yl)silane (PubChem CID 177327511) has the molecular formula C30H48BFO5Si and a molecular weight of 546.61 g/mol. Its IUPAC name is 3-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy-tri(propan-2-yl)silane.
| Compound Name | 3-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 177327511 |
| Molecular Formula | C30H48BFO5Si |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 3-[2-fluoro-6-(methoxymethoxy)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]propoxy-tri(propan-2-yl)silane |
| SMILES | COCOc1cc(B2OC(C)(C)C(C)(C)O2)c2c(CCCO[Si](C(C)C)(C(C)C)C(C)C)c(F)ccc2c1 |
| InChI | InChI=1S/C30H48BFO5Si/c1-20(2)38(21(3)4,22(5)6)35-16-12-13-25-27(32)15-14-23-17-24(34-19-33-11)18-26(28(23)25)31-36-29(7,8)30(9,10)37-31/h14-15,17-18,20-22H,12-13,16,19H2,1-11H3 |
| InChIKey | HIBVWSNUTOGUTG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|