About (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine
(Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine (PubChem CID 177327776) has the molecular formula C6H12F2N2
and a molecular weight of 150.17 g/mol. Its IUPAC name is (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine.
Molecular Properties
| Compound Name | (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine |
| PubChem CID | 177327776 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine |
| SMILES | CC/C(N)=C(/NC)C(F)F |
| InChI | InChI=1S/C6H12F2N2/c1-3-4(9)5(10-2)6(7)8/h6,10H,3,9H2,1-2H3/b5-4- |
| InChIKey | JQDIAOQBZFHMSZ-PLNGDYQASA-N |
| XLogP | 1.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine?
The IUPAC name of (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine (CID 177327776) is (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine.
What is the SMILES notation for (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine?
The canonical SMILES for (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine is CC/C(N)=C(/NC)C(F)F.
What is the InChIKey of (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine?
The InChIKey is JQDIAOQBZFHMSZ-PLNGDYQASA-N. The full InChI is InChI=1S/C6H12F2N2/c1-3-4(9)5(10-2)6(7)8/h6,10H,3,9H2,1-2H3/b5-4-.
What are the key properties of (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine?
(Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine has a molecular weight of 150.17 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1-difluoro-2-N-methylpent-2-ene-2,3-diamine is sourced from PubChem (CID 177327776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).