About 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole
5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole (PubChem CID 177327864) has the molecular formula C8H12F2N2
and a molecular weight of 174.19 g/mol. Its IUPAC name is 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole |
| PubChem CID | 177327864 |
| Molecular Formula | C8H12F2N2 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole |
| SMILES | CCc1nc(C)n(C)c1C(F)F |
| InChI | InChI=1S/C8H12F2N2/c1-4-6-7(8(9)10)12(3)5(2)11-6/h8H,4H2,1-3H3 |
| InChIKey | NTRLVGNIKUJXTM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole?
The IUPAC name of 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole (CID 177327864) is 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole.
What is the SMILES notation for 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole?
The canonical SMILES for 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole is CCc1nc(C)n(C)c1C(F)F.
What is the InChIKey of 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole?
The InChIKey is NTRLVGNIKUJXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2/c1-4-6-7(8(9)10)12(3)5(2)11-6/h8H,4H2,1-3H3.
What are the key properties of 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole?
5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole has a molecular weight of 174.19 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-4-ethyl-1,2-dimethylimidazole is sourced from PubChem (CID 177327864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).