About 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine
6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine (PubChem CID 177327972) has the molecular formula C9H13F2N
and a molecular weight of 173.21 g/mol. Its IUPAC name is 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine |
| PubChem CID | 177327972 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine |
| SMILES | CC(C)C1=NC(C(F)F)=CCC1 |
| InChI | InChI=1S/C9H13F2N/c1-6(2)7-4-3-5-8(12-7)9(10)11/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | FVQVCFBMEITHNR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine?
The IUPAC name of 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine (CID 177327972) is 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine.
What is the SMILES notation for 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine?
The canonical SMILES for 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine is CC(C)C1=NC(C(F)F)=CCC1.
What is the InChIKey of 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine?
The InChIKey is FVQVCFBMEITHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N/c1-6(2)7-4-3-5-8(12-7)9(10)11/h5-6,9H,3-4H2,1-2H3.
What are the key properties of 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine?
6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine has a molecular weight of 173.21 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-2-propan-2-yl-3,4-dihydropyridine is sourced from PubChem (CID 177327972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).