C22H27F5N6O — CID 177328135
6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3-difluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]pyridazin-3-one (PubChem CID 177328135) has the molecular formula C22H27F5N6O and a molecular weight of 486.49 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3-difluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]pyridazin-3-one.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3-difluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 177328135 |
| Molecular Formula | C22H27F5N6O |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3-difluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]pyridazin-3-one |
| SMILES | CN(N)/C(=C(\N)c1cc(C2CCCCC2)c(=O)n(Cc2ncccc2CC(F)(F)F)n1)C(F)F |
| InChI | InChI=1S/C22H27F5N6O/c1-32(29)19(20(23)24)18(28)16-10-15(13-6-3-2-4-7-13)21(34)33(31-16)12-17-14(8-5-9-30-17)11-22(25,26)27/h5,8-10,13,20H,2-4,6-7,11-12,28-29H2,1H3/b19-18- |
| InChIKey | ZWLJXFBMMMJZRG-HNENSFHCSA-N |
| XLogP | 3.54 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|