About 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one
6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one (PubChem CID 177328673) has the molecular formula C7H7FN2O
and a molecular weight of 154.14 g/mol. Its IUPAC name is 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one |
| PubChem CID | 177328673 |
| Molecular Formula | C7H7FN2O |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc([C@@H]2C[C@H]2F)[nH]1 |
| InChI | InChI=1S/C7H7FN2O/c8-5-3-4(5)6-1-2-9-7(11)10-6/h1-2,4-5H,3H2,(H,9,10,11)/t4-,5-/m1/s1 |
| InChIKey | URJSXIBUENNWAR-RFZPGFLSSA-N |
| XLogP | 0.60 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one?
The IUPAC name of 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one (CID 177328673) is 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one.
What is the SMILES notation for 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one?
The canonical SMILES for 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one is O=c1nccc([C@@H]2C[C@H]2F)[nH]1.
What is the InChIKey of 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one?
The InChIKey is URJSXIBUENNWAR-RFZPGFLSSA-N. The full InChI is InChI=1S/C7H7FN2O/c8-5-3-4(5)6-1-2-9-7(11)10-6/h1-2,4-5H,3H2,(H,9,10,11)/t4-,5-/m1/s1.
What are the key properties of 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one?
6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one has a molecular weight of 154.14 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrimidin-2-one is sourced from PubChem (CID 177328673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).