About (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol
(4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol (PubChem CID 177329741) has the molecular formula C12H16BrClIN2OP
and a molecular weight of 477.51 g/mol. Its IUPAC name is (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol.
Molecular Properties
| Compound Name | (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol |
| PubChem CID | 177329741 |
| Molecular Formula | C12H16BrClIN2OP |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 475.89 |
| IUPAC Name | (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol |
| SMILES | C1CC1.CCO.Clc1cc(Br)c2cnn(PI)c2c1 |
| InChI | InChI=1S/C7H4BrClIN2P.C3H6.C2H6O/c8-6-1-4(9)2-7-5(6)3-11-12(7)13-10;1-2-3-1;1-2-3/h1-3,13H;1-3H2;3H,2H2,1H3 |
| InChIKey | ZWSQDOIHCGVTOW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol?
The IUPAC name of (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol (CID 177329741) is (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol.
What is the SMILES notation for (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol?
The canonical SMILES for (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol is C1CC1.CCO.Clc1cc(Br)c2cnn(PI)c2c1.
What is the InChIKey of (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol?
The InChIKey is ZWSQDOIHCGVTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClIN2P.C3H6.C2H6O/c8-6-1-4(9)2-7-5(6)3-11-12(7)13-10;1-2-3-1;1-2-3/h1-3,13H;1-3H2;3H,2H2,1H3.
What are the key properties of (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol?
(4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol has a molecular weight of 477.51 g/mol, XLogP of 5.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-6-chloroindazol-1-yl)-iodophosphane;cyclopropane;ethanol is sourced from PubChem (CID 177329741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).