C31H46BClN4O5 — CID 177330275
1-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-2-(cyclopropylmethoxy)ethanone;6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 177330275) has the molecular formula C31H46BClN4O5 and a molecular weight of 601.00 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-2-(cyclopropylmethoxy)ethanone;6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-2-(cyclopropylmethoxy)ethanone;6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 177330275 |
| Molecular Formula | C31H46BClN4O5 |
| Molecular Weight | 601.00 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-2-(cyclopropylmethoxy)ethanone;6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC1(C)OB(c2cc(Cl)cc3c2cnn3C2CCCCO2)OC1(C)C.O=C(COCC1CC1)N1CCC2CCNCC21 |
| InChI | InChI=1S/C18H24BClN2O3.C13H22N2O2/c1-17(2)18(3,4)25-19(24-17)14-9-12(20)10-15-13(14)11-21-22(15)16-7-5-6-8-23-16;16-13(9-17-8-10-1-2-10)15-6-4-11-3-5-14-7-12(11)15/h9-11,16H,5-8H2,1-4H3;10-12,14H,1-9H2 |
| InChIKey | ZSBCGAALOPKPIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|