About 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine
1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine (PubChem CID 177330683) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine |
| PubChem CID | 177330683 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine |
| SMILES | CC(C)OC[C@@]1(CN(C)C)CC1(F)F |
| InChI | InChI=1S/C10H19F2NO/c1-8(2)14-7-9(6-13(3)4)5-10(9,11)12/h8H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | LWDSWABPQPIJJQ-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine (CID 177330683) is 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine is CC(C)OC[C@@]1(CN(C)C)CC1(F)F.
What is the InChIKey of 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
The InChIKey is LWDSWABPQPIJJQ-VIFPVBQESA-N. The full InChI is InChI=1S/C10H19F2NO/c1-8(2)14-7-9(6-13(3)4)5-10(9,11)12/h8H,5-7H2,1-4H3/t9-/m0/s1.
What are the key properties of 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine has a molecular weight of 207.26 g/mol, XLogP of 2.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 177330683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).