C35H39ClN6O5 — CID 177332377
5-chloro-7-[(2,4-dimethoxyphenyl)methyl-methylamino]imidazo[4,5-b]pyridine-3-carboxamide;3-(cyclobutyloxymethyl)-5-(2-methoxyphenyl)aniline (PubChem CID 177332377) has the molecular formula C35H39ClN6O5 and a molecular weight of 659.19 g/mol. Its IUPAC name is 5-chloro-7-[(2,4-dimethoxyphenyl)methyl-methylamino]imidazo[4,5-b]pyridine-3-carboxamide;3-(cyclobutyloxymethyl)-5-(2-methoxyphenyl)aniline.
| Compound Name | 5-chloro-7-[(2,4-dimethoxyphenyl)methyl-methylamino]imidazo[4,5-b]pyridine-3-carboxamide;3-(cyclobutyloxymethyl)-5-(2-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 177332377 |
| Molecular Formula | C35H39ClN6O5 |
| Molecular Weight | 659.19 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 5-chloro-7-[(2,4-dimethoxyphenyl)methyl-methylamino]imidazo[4,5-b]pyridine-3-carboxamide;3-(cyclobutyloxymethyl)-5-(2-methoxyphenyl)aniline |
| SMILES | COc1ccc(CN(C)c2cc(Cl)nc3c2ncn3C(N)=O)c(OC)c1.COc1ccccc1-c1cc(N)cc(COC2CCC2)c1 |
| InChI | InChI=1S/C18H21NO2.C17H18ClN5O3/c1-20-18-8-3-2-7-17(18)14-9-13(10-15(19)11-14)12-21-16-5-4-6-16;1-22(8-10-4-5-11(25-2)6-13(10)26-3)12-7-14(18)21-16-15(12)20-9-23(16)17(19)24/h2-3,7-11,16H,4-6,12,19H2,1H3;4-7,9H,8H2,1-3H3,(H2,19,24) |
| InChIKey | WWGWMNFOUDUBNH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.19 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|