C18H21ClN4O2S — CID 177332553
2-chloro-4-(methanethioylamino)benzoic acid;1-methyl-4-pyridin-3-ylpiperazine (PubChem CID 177332553) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is 2-chloro-4-(methanethioylamino)benzoic acid;1-methyl-4-pyridin-3-ylpiperazine.
| Compound Name | 2-chloro-4-(methanethioylamino)benzoic acid;1-methyl-4-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 177332553 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-chloro-4-(methanethioylamino)benzoic acid;1-methyl-4-pyridin-3-ylpiperazine |
| SMILES | CN1CCN(c2cccnc2)CC1.O=C(O)c1ccc(NC=S)cc1Cl |
| InChI | InChI=1S/C10H15N3.C8H6ClNO2S/c1-12-5-7-13(8-6-12)10-3-2-4-11-9-10;9-7-3-5(10-4-13)1-2-6(7)8(11)12/h2-4,9H,5-8H2,1H3;1-4H,(H,10,13)(H,11,12) |
| InChIKey | MXNBEQNQAKJSGX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|